[4-(3-chloro-4-fluorobenzene-1-sulfonyl)-6-fluoroquinolin-3-yl](4-methylpiperidin-1-yl)methanone
Chemical Structure Depiction of
[4-(3-chloro-4-fluorobenzene-1-sulfonyl)-6-fluoroquinolin-3-yl](4-methylpiperidin-1-yl)methanone
[4-(3-chloro-4-fluorobenzene-1-sulfonyl)-6-fluoroquinolin-3-yl](4-methylpiperidin-1-yl)methanone
Compound characteristics
| Compound ID: | E581-1695 |
| Compound Name: | [4-(3-chloro-4-fluorobenzene-1-sulfonyl)-6-fluoroquinolin-3-yl](4-methylpiperidin-1-yl)methanone |
| Molecular Weight: | 464.92 |
| Molecular Formula: | C22 H19 Cl F2 N2 O3 S |
| Smiles: | CC1CCN(CC1)C(c1cnc2ccc(cc2c1S(c1ccc(c(c1)[Cl])F)(=O)=O)F)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1862 |
| logD: | 4.1861 |
| logSw: | -4.4155 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 55.24 |
| InChI Key: | HMTZKTAYQIGQPX-UHFFFAOYSA-N |