[4-(4-ethoxybenzene-1-sulfonyl)-6-fluoroquinolin-3-yl](morpholin-4-yl)methanone
Chemical Structure Depiction of
[4-(4-ethoxybenzene-1-sulfonyl)-6-fluoroquinolin-3-yl](morpholin-4-yl)methanone
[4-(4-ethoxybenzene-1-sulfonyl)-6-fluoroquinolin-3-yl](morpholin-4-yl)methanone
Compound characteristics
| Compound ID: | E581-2129 |
| Compound Name: | [4-(4-ethoxybenzene-1-sulfonyl)-6-fluoroquinolin-3-yl](morpholin-4-yl)methanone |
| Molecular Weight: | 444.48 |
| Molecular Formula: | C22 H21 F N2 O5 S |
| Smiles: | CCOc1ccc(cc1)S(c1c(cnc2ccc(cc12)F)C(N1CCOCC1)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.7059 |
| logD: | 2.7059 |
| logSw: | -3.1482 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 70.272 |
| InChI Key: | YIVCZJAVHUHJSH-UHFFFAOYSA-N |