3-(benzenesulfonyl)-4-hydroxy-N-[(4-methylphenyl)methyl]-2-oxo-1,2-dihydroquinoline-7-carboxamide
Chemical Structure Depiction of
3-(benzenesulfonyl)-4-hydroxy-N-[(4-methylphenyl)methyl]-2-oxo-1,2-dihydroquinoline-7-carboxamide
3-(benzenesulfonyl)-4-hydroxy-N-[(4-methylphenyl)methyl]-2-oxo-1,2-dihydroquinoline-7-carboxamide
Compound characteristics
| Compound ID: | E582-0037 |
| Compound Name: | 3-(benzenesulfonyl)-4-hydroxy-N-[(4-methylphenyl)methyl]-2-oxo-1,2-dihydroquinoline-7-carboxamide |
| Molecular Weight: | 448.5 |
| Molecular Formula: | C24 H20 N2 O5 S |
| Smiles: | Cc1ccc(CNC(c2ccc3C(=C(C(Nc3c2)=O)S(c2ccccc2)(=O)=O)O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 2.5875 |
| logD: | -1.3557 |
| logSw: | -3.3552 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 94.101 |
| InChI Key: | NWHREXUHLPHNJM-UHFFFAOYSA-N |