3-(benzenesulfonyl)-4-hydroxy-N-(4-methylphenyl)-2-oxo-1,2-dihydroquinoline-7-carboxamide
Chemical Structure Depiction of
3-(benzenesulfonyl)-4-hydroxy-N-(4-methylphenyl)-2-oxo-1,2-dihydroquinoline-7-carboxamide
3-(benzenesulfonyl)-4-hydroxy-N-(4-methylphenyl)-2-oxo-1,2-dihydroquinoline-7-carboxamide
Compound characteristics
| Compound ID: | E582-0235 |
| Compound Name: | 3-(benzenesulfonyl)-4-hydroxy-N-(4-methylphenyl)-2-oxo-1,2-dihydroquinoline-7-carboxamide |
| Molecular Weight: | 434.47 |
| Molecular Formula: | C23 H18 N2 O5 S |
| Smiles: | Cc1ccc(cc1)NC(c1ccc2C(=C(C(Nc2c1)=O)S(c1ccccc1)(=O)=O)O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9216 |
| logD: | -1.0216 |
| logSw: | -3.6328 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 92.779 |
| InChI Key: | ROXMLEXYYUEHHA-UHFFFAOYSA-N |