1-(morpholin-4-yl)-2-[3-({[3-(trifluoromethyl)phenyl]methyl}sulfanyl)-1H-indol-1-yl]ethan-1-one
Chemical Structure Depiction of
1-(morpholin-4-yl)-2-[3-({[3-(trifluoromethyl)phenyl]methyl}sulfanyl)-1H-indol-1-yl]ethan-1-one
1-(morpholin-4-yl)-2-[3-({[3-(trifluoromethyl)phenyl]methyl}sulfanyl)-1H-indol-1-yl]ethan-1-one
Compound characteristics
| Compound ID: | E587-0372 |
| Compound Name: | 1-(morpholin-4-yl)-2-[3-({[3-(trifluoromethyl)phenyl]methyl}sulfanyl)-1H-indol-1-yl]ethan-1-one |
| Molecular Weight: | 434.48 |
| Molecular Formula: | C22 H21 F3 N2 O2 S |
| Smiles: | C1COCCN1C(Cn1cc(c2ccccc12)SCc1cccc(c1)C(F)(F)F)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7342 |
| logD: | 3.7342 |
| logSw: | -4.0242 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 26 |
| InChI Key: | RORKULCAXDFEMO-UHFFFAOYSA-N |