2-({1-[2-(azepan-1-yl)-2-oxoethyl]-1H-indol-3-yl}sulfanyl)-N-(3-chlorophenyl)acetamide
Chemical Structure Depiction of
2-({1-[2-(azepan-1-yl)-2-oxoethyl]-1H-indol-3-yl}sulfanyl)-N-(3-chlorophenyl)acetamide
2-({1-[2-(azepan-1-yl)-2-oxoethyl]-1H-indol-3-yl}sulfanyl)-N-(3-chlorophenyl)acetamide
Compound characteristics
| Compound ID: | E587-0411 |
| Compound Name: | 2-({1-[2-(azepan-1-yl)-2-oxoethyl]-1H-indol-3-yl}sulfanyl)-N-(3-chlorophenyl)acetamide |
| Molecular Weight: | 456.01 |
| Molecular Formula: | C24 H26 Cl N3 O2 S |
| Smiles: | C1CCCN(CC1)C(Cn1cc(c2ccccc12)SCC(Nc1cccc(c1)[Cl])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7835 |
| logD: | 4.7833 |
| logSw: | -4.8624 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.572 |
| InChI Key: | AXBNLLYGFURZCW-UHFFFAOYSA-N |