2-({1-[2-(azepan-1-yl)-2-oxoethyl]-1H-indol-3-yl}sulfanyl)-N-(2,4-difluorophenyl)acetamide
Chemical Structure Depiction of
2-({1-[2-(azepan-1-yl)-2-oxoethyl]-1H-indol-3-yl}sulfanyl)-N-(2,4-difluorophenyl)acetamide
2-({1-[2-(azepan-1-yl)-2-oxoethyl]-1H-indol-3-yl}sulfanyl)-N-(2,4-difluorophenyl)acetamide
Compound characteristics
| Compound ID: | E587-0414 |
| Compound Name: | 2-({1-[2-(azepan-1-yl)-2-oxoethyl]-1H-indol-3-yl}sulfanyl)-N-(2,4-difluorophenyl)acetamide |
| Molecular Weight: | 457.54 |
| Molecular Formula: | C24 H25 F2 N3 O2 S |
| Smiles: | C1CCCN(CC1)C(Cn1cc(c2ccccc12)SCC(Nc1ccc(cc1F)F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.9458 |
| logD: | 3.9346 |
| logSw: | -3.8963 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.874 |
| InChI Key: | WKWBDDKFHKDJSV-UHFFFAOYSA-N |