4-{[(1-acetyl-2-methyl-2,3-dihydro-1H-indole-5-sulfonyl)amino]methyl}-N-benzylcyclohexane-1-carboxamide
Chemical Structure Depiction of
4-{[(1-acetyl-2-methyl-2,3-dihydro-1H-indole-5-sulfonyl)amino]methyl}-N-benzylcyclohexane-1-carboxamide
4-{[(1-acetyl-2-methyl-2,3-dihydro-1H-indole-5-sulfonyl)amino]methyl}-N-benzylcyclohexane-1-carboxamide
Compound characteristics
| Compound ID: | E589-3040 |
| Compound Name: | 4-{[(1-acetyl-2-methyl-2,3-dihydro-1H-indole-5-sulfonyl)amino]methyl}-N-benzylcyclohexane-1-carboxamide |
| Molecular Weight: | 483.63 |
| Molecular Formula: | C26 H33 N3 O4 S |
| Smiles: | CC1Cc2cc(ccc2N1C(C)=O)S(NCC1CCC(CC1)C(NCc1ccccc1)=O)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.4657 |
| logD: | 3.4657 |
| logSw: | -3.9168 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 81.959 |
| InChI Key: | VMCAWWPSNKVPJR-OSFYOIPJSA-N |