N-(4-chloro-2-methylphenyl)-N~2~-methyl-N~2~-(2-oxo-1,2-dihydroquinoline-6-sulfonyl)glycinamide
Chemical Structure Depiction of
N-(4-chloro-2-methylphenyl)-N~2~-methyl-N~2~-(2-oxo-1,2-dihydroquinoline-6-sulfonyl)glycinamide
N-(4-chloro-2-methylphenyl)-N~2~-methyl-N~2~-(2-oxo-1,2-dihydroquinoline-6-sulfonyl)glycinamide
Compound characteristics
| Compound ID: | E589-4534 |
| Compound Name: | N-(4-chloro-2-methylphenyl)-N~2~-methyl-N~2~-(2-oxo-1,2-dihydroquinoline-6-sulfonyl)glycinamide |
| Molecular Weight: | 419.89 |
| Molecular Formula: | C19 H18 Cl N3 O4 S |
| Smiles: | Cc1cc(ccc1NC(CN(C)S(c1ccc2c(C=CC(N2)=O)c1)(=O)=O)=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 3.219 |
| logD: | 3.2128 |
| logSw: | -3.5801 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 80.075 |
| InChI Key: | PLVWWJKGSDCVTN-UHFFFAOYSA-N |