1-(4-chlorophenyl)-4-[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]-1H-1,2,3-triazol-5-amine
Chemical Structure Depiction of
1-(4-chlorophenyl)-4-[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]-1H-1,2,3-triazol-5-amine
1-(4-chlorophenyl)-4-[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]-1H-1,2,3-triazol-5-amine
Compound characteristics
| Compound ID: | E595-0518 |
| Compound Name: | 1-(4-chlorophenyl)-4-[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]-1H-1,2,3-triazol-5-amine |
| Molecular Weight: | 382.81 |
| Molecular Formula: | C18 H15 Cl N6 O2 |
| Smiles: | CCOc1ccc(cc1)c1nc(c2c(N)n(c3ccc(cc3)[Cl])nn2)on1 |
| Stereo: | ACHIRAL |
| logP: | 4.0244 |
| logD: | 4.0244 |
| logSw: | -4.5113 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 84.862 |
| InChI Key: | ZQMVDRRXUKHPIL-UHFFFAOYSA-N |