3-(3,4-dimethylbenzene-1-sulfonyl)-6-fluoro-1-methyl-7-(morpholin-4-yl)quinolin-4(1H)-one
Chemical Structure Depiction of
3-(3,4-dimethylbenzene-1-sulfonyl)-6-fluoro-1-methyl-7-(morpholin-4-yl)quinolin-4(1H)-one
3-(3,4-dimethylbenzene-1-sulfonyl)-6-fluoro-1-methyl-7-(morpholin-4-yl)quinolin-4(1H)-one
Compound characteristics
| Compound ID: | E599-0146 |
| Compound Name: | 3-(3,4-dimethylbenzene-1-sulfonyl)-6-fluoro-1-methyl-7-(morpholin-4-yl)quinolin-4(1H)-one |
| Molecular Weight: | 430.5 |
| Molecular Formula: | C22 H23 F N2 O4 S |
| Smiles: | Cc1ccc(cc1C)S(C1=CN(C)c2cc(c(cc2C1=O)F)N1CCOCC1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.8161 |
| logD: | 2.8161 |
| logSw: | -3.4092 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 56.11 |
| InChI Key: | WTDXUNRJHCEERI-UHFFFAOYSA-N |