3-(2,4-dimethylbenzene-1-sulfonyl)-1-ethyl-6-fluoro-7-(2-methylpiperidin-1-yl)quinolin-4(1H)-one
Chemical Structure Depiction of
3-(2,4-dimethylbenzene-1-sulfonyl)-1-ethyl-6-fluoro-7-(2-methylpiperidin-1-yl)quinolin-4(1H)-one
3-(2,4-dimethylbenzene-1-sulfonyl)-1-ethyl-6-fluoro-7-(2-methylpiperidin-1-yl)quinolin-4(1H)-one
Compound characteristics
| Compound ID: | E599-0346 |
| Compound Name: | 3-(2,4-dimethylbenzene-1-sulfonyl)-1-ethyl-6-fluoro-7-(2-methylpiperidin-1-yl)quinolin-4(1H)-one |
| Molecular Weight: | 456.58 |
| Molecular Formula: | C25 H29 F N2 O3 S |
| Smiles: | CCN1C=C(C(c2cc(c(cc12)N1CCCCC1C)F)=O)S(c1ccc(C)cc1C)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.6411 |
| logD: | 4.6411 |
| logSw: | -4.4223 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 47.496 |
| InChI Key: | WYNBLLGHLMUMOD-SFHVURJKSA-N |