N-[(2H-1,3-benzodioxol-5-yl)methyl]-3-methyl-2-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)butanamide
Chemical Structure Depiction of
N-[(2H-1,3-benzodioxol-5-yl)methyl]-3-methyl-2-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)butanamide
N-[(2H-1,3-benzodioxol-5-yl)methyl]-3-methyl-2-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)butanamide
Compound characteristics
| Compound ID: | E612-0687 |
| Compound Name: | N-[(2H-1,3-benzodioxol-5-yl)methyl]-3-methyl-2-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)butanamide |
| Molecular Weight: | 366.42 |
| Molecular Formula: | C21 H22 N2 O4 |
| Smiles: | CC(C)C(C(NCc1ccc2c(c1)OCO2)=O)N1Cc2ccccc2C1=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.8884 |
| logD: | 2.8884 |
| logSw: | -3.4576 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.812 |
| InChI Key: | XDHJEXYQVFRFGI-IBGZPJMESA-N |