4-methyl-2-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)-N-[4-(trifluoromethoxy)phenyl]pentanamide
Chemical Structure Depiction of
4-methyl-2-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)-N-[4-(trifluoromethoxy)phenyl]pentanamide
4-methyl-2-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)-N-[4-(trifluoromethoxy)phenyl]pentanamide
Compound characteristics
| Compound ID: | E612-0976 |
| Compound Name: | 4-methyl-2-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)-N-[4-(trifluoromethoxy)phenyl]pentanamide |
| Molecular Weight: | 406.4 |
| Molecular Formula: | C21 H21 F3 N2 O3 |
| Smiles: | CC(C)CC(C(Nc1ccc(cc1)OC(F)(F)F)=O)N1Cc2ccccc2C1=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.0268 |
| logD: | 5.0268 |
| logSw: | -4.5345 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.275 |
| InChI Key: | SJTQSVWJQPIUHD-SFHVURJKSA-N |