1-[4-(4-chlorophenyl)piperazin-1-yl]-2-{[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methoxy}ethan-1-one
Chemical Structure Depiction of
1-[4-(4-chlorophenyl)piperazin-1-yl]-2-{[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methoxy}ethan-1-one
1-[4-(4-chlorophenyl)piperazin-1-yl]-2-{[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methoxy}ethan-1-one
Compound characteristics
| Compound ID: | E613-0564 |
| Compound Name: | 1-[4-(4-chlorophenyl)piperazin-1-yl]-2-{[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methoxy}ethan-1-one |
| Molecular Weight: | 429.88 |
| Molecular Formula: | C22 H21 Cl F N3 O3 |
| Smiles: | C1CN(CCN1C(COCc1cc(c2ccc(cc2)F)on1)=O)c1ccc(cc1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 3.8964 |
| logD: | 3.8964 |
| logSw: | -4.4706 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 50.084 |
| InChI Key: | XZXICXAYHSIWGE-UHFFFAOYSA-N |