N-benzyl-N-methyl-2-{[5-(thiophen-2-yl)-1,2-oxazol-3-yl]methoxy}acetamide
Chemical Structure Depiction of
N-benzyl-N-methyl-2-{[5-(thiophen-2-yl)-1,2-oxazol-3-yl]methoxy}acetamide
N-benzyl-N-methyl-2-{[5-(thiophen-2-yl)-1,2-oxazol-3-yl]methoxy}acetamide
Compound characteristics
| Compound ID: | E613-0684 |
| Compound Name: | N-benzyl-N-methyl-2-{[5-(thiophen-2-yl)-1,2-oxazol-3-yl]methoxy}acetamide |
| Molecular Weight: | 342.41 |
| Molecular Formula: | C18 H18 N2 O3 S |
| Smiles: | CN(Cc1ccccc1)C(COCc1cc(c2cccs2)on1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4637 |
| logD: | 3.4637 |
| logSw: | -3.7741 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 47.345 |
| InChI Key: | TZUFFEHTZRVYLU-UHFFFAOYSA-N |