N-{1-[(4-chlorophenyl)methyl]-5-methyl-1H-pyrazol-3-yl}-2-{[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy}acetamide
Chemical Structure Depiction of
N-{1-[(4-chlorophenyl)methyl]-5-methyl-1H-pyrazol-3-yl}-2-{[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy}acetamide
N-{1-[(4-chlorophenyl)methyl]-5-methyl-1H-pyrazol-3-yl}-2-{[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy}acetamide
Compound characteristics
| Compound ID: | E613-1110 |
| Compound Name: | N-{1-[(4-chlorophenyl)methyl]-5-methyl-1H-pyrazol-3-yl}-2-{[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy}acetamide |
| Molecular Weight: | 426.86 |
| Molecular Formula: | C21 H19 Cl N4 O4 |
| Smiles: | Cc1cc(NC(COCc2cc(c3ccco3)on2)=O)nn1Cc1ccc(cc1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 3.3193 |
| logD: | 3.2946 |
| logSw: | -3.596 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 76.656 |
| InChI Key: | GWLUFYQYVINASA-UHFFFAOYSA-N |