N-(3-ethoxypropyl)-1-[6-(4-fluorophenyl)imidazo[2,1-b][1,3,4]thiadiazol-2-yl]piperidine-4-carboxamide
Chemical Structure Depiction of
N-(3-ethoxypropyl)-1-[6-(4-fluorophenyl)imidazo[2,1-b][1,3,4]thiadiazol-2-yl]piperidine-4-carboxamide
N-(3-ethoxypropyl)-1-[6-(4-fluorophenyl)imidazo[2,1-b][1,3,4]thiadiazol-2-yl]piperidine-4-carboxamide
Compound characteristics
| Compound ID: | E626-0275 |
| Compound Name: | N-(3-ethoxypropyl)-1-[6-(4-fluorophenyl)imidazo[2,1-b][1,3,4]thiadiazol-2-yl]piperidine-4-carboxamide |
| Molecular Weight: | 431.53 |
| Molecular Formula: | C21 H26 F N5 O2 S |
| Smiles: | CCOCCCNC(C1CCN(CC1)c1nn2cc(c3ccc(cc3)F)nc2s1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.2616 |
| logD: | 3.2615 |
| logSw: | -3.1029 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.03 |
| InChI Key: | MGFPPIUTXOIBAK-UHFFFAOYSA-N |