N-(4-chlorophenyl)-1-[6-(4-methylphenyl)imidazo[2,1-b][1,3,4]thiadiazol-2-yl]piperidine-4-carboxamide
Chemical Structure Depiction of
N-(4-chlorophenyl)-1-[6-(4-methylphenyl)imidazo[2,1-b][1,3,4]thiadiazol-2-yl]piperidine-4-carboxamide
N-(4-chlorophenyl)-1-[6-(4-methylphenyl)imidazo[2,1-b][1,3,4]thiadiazol-2-yl]piperidine-4-carboxamide
Compound characteristics
| Compound ID: | E626-0382 |
| Compound Name: | N-(4-chlorophenyl)-1-[6-(4-methylphenyl)imidazo[2,1-b][1,3,4]thiadiazol-2-yl]piperidine-4-carboxamide |
| Molecular Weight: | 451.98 |
| Molecular Formula: | C23 H22 Cl N5 O S |
| Smiles: | Cc1ccc(cc1)c1cn2c(n1)sc(n2)N1CCC(CC1)C(Nc1ccc(cc1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 5.3257 |
| logD: | 5.3245 |
| logSw: | -5.9868 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.617 |
| InChI Key: | GEUYLOGTDACFMY-UHFFFAOYSA-N |