N-(4-chlorophenyl)-2,3-dihydro-4H-1,4-benzothiazine-4-carboxamide
Chemical Structure Depiction of
N-(4-chlorophenyl)-2,3-dihydro-4H-1,4-benzothiazine-4-carboxamide
N-(4-chlorophenyl)-2,3-dihydro-4H-1,4-benzothiazine-4-carboxamide
Compound characteristics
| Compound ID: | E628-0896 |
| Compound Name: | N-(4-chlorophenyl)-2,3-dihydro-4H-1,4-benzothiazine-4-carboxamide |
| Molecular Weight: | 304.8 |
| Molecular Formula: | C15 H13 Cl N2 O S |
| Smiles: | C1CSc2ccccc2N1C(Nc1ccc(cc1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 4.1729 |
| logD: | 4.1729 |
| logSw: | -4.5325 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 24.3721 |
| InChI Key: | LPPASUBPOSZAQD-UHFFFAOYSA-N |