N-(4-bromo-2-fluorophenyl)-2-methyl-2,3-dihydro-4H-1,4-benzothiazine-4-carboxamide
Chemical Structure Depiction of
N-(4-bromo-2-fluorophenyl)-2-methyl-2,3-dihydro-4H-1,4-benzothiazine-4-carboxamide
N-(4-bromo-2-fluorophenyl)-2-methyl-2,3-dihydro-4H-1,4-benzothiazine-4-carboxamide
Compound characteristics
| Compound ID: | E628-0988 |
| Compound Name: | N-(4-bromo-2-fluorophenyl)-2-methyl-2,3-dihydro-4H-1,4-benzothiazine-4-carboxamide |
| Molecular Weight: | 381.26 |
| Molecular Formula: | C16 H14 Br F N2 O S |
| Smiles: | CC1CN(C(Nc2ccc(cc2F)[Br])=O)c2ccccc2S1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.1787 |
| logD: | 5.1785 |
| logSw: | -4.9023 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 23.6077 |
| InChI Key: | RHMVKKJZRCRVAW-SNVBAGLBSA-N |