2-ethyl-N-(4-ethylphenyl)-2,3-dihydro-4H-1,4-benzothiazine-4-carboxamide
Chemical Structure Depiction of
2-ethyl-N-(4-ethylphenyl)-2,3-dihydro-4H-1,4-benzothiazine-4-carboxamide
2-ethyl-N-(4-ethylphenyl)-2,3-dihydro-4H-1,4-benzothiazine-4-carboxamide
Compound characteristics
| Compound ID: | E628-1025 |
| Compound Name: | 2-ethyl-N-(4-ethylphenyl)-2,3-dihydro-4H-1,4-benzothiazine-4-carboxamide |
| Molecular Weight: | 326.46 |
| Molecular Formula: | C19 H22 N2 O S |
| Smiles: | CCC1CN(C(Nc2ccc(CC)cc2)=O)c2ccccc2S1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.6875 |
| logD: | 5.6875 |
| logSw: | -5.3917 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 24.3055 |
| InChI Key: | WZNYKVPFOWSINN-INIZCTEOSA-N |