1-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2-[5-fluoro-2-(thiophen-2-yl)-1H-indol-1-yl]ethan-1-one
Chemical Structure Depiction of
1-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2-[5-fluoro-2-(thiophen-2-yl)-1H-indol-1-yl]ethan-1-one
1-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2-[5-fluoro-2-(thiophen-2-yl)-1H-indol-1-yl]ethan-1-one
Compound characteristics
| Compound ID: | E629-1434 |
| Compound Name: | 1-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2-[5-fluoro-2-(thiophen-2-yl)-1H-indol-1-yl]ethan-1-one |
| Molecular Weight: | 467.99 |
| Molecular Formula: | C25 H23 Cl F N3 O S |
| Smiles: | Cc1ccc(cc1N1CCN(CC1)C(Cn1c(cc2cc(ccc12)F)c1cccs1)=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 6.2118 |
| logD: | 6.2118 |
| logSw: | -6.1626 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 20.7911 |
| InChI Key: | MZBBLRZSUWZYBR-UHFFFAOYSA-N |