N-[(2H-1,3-benzodioxol-5-yl)methyl]-2-[5-chloro-2-(thiophen-2-yl)-1H-indol-1-yl]acetamide
Chemical Structure Depiction of
N-[(2H-1,3-benzodioxol-5-yl)methyl]-2-[5-chloro-2-(thiophen-2-yl)-1H-indol-1-yl]acetamide
N-[(2H-1,3-benzodioxol-5-yl)methyl]-2-[5-chloro-2-(thiophen-2-yl)-1H-indol-1-yl]acetamide
Compound characteristics
| Compound ID: | E629-1727 |
| Compound Name: | N-[(2H-1,3-benzodioxol-5-yl)methyl]-2-[5-chloro-2-(thiophen-2-yl)-1H-indol-1-yl]acetamide |
| Molecular Weight: | 424.9 |
| Molecular Formula: | C22 H17 Cl N2 O3 S |
| Smiles: | C(c1ccc2c(c1)OCO2)NC(Cn1c(cc2cc(ccc12)[Cl])c1cccs1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.4754 |
| logD: | 5.4754 |
| logSw: | -6.0625 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.026 |
| InChI Key: | LXKILONERDEGTL-UHFFFAOYSA-N |