N-(5-chloro-2-methoxyphenyl)-N'-{1-[6-methyl-2-(1H-pyrrol-1-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]propyl}urea
Chemical Structure Depiction of
N-(5-chloro-2-methoxyphenyl)-N'-{1-[6-methyl-2-(1H-pyrrol-1-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]propyl}urea
N-(5-chloro-2-methoxyphenyl)-N'-{1-[6-methyl-2-(1H-pyrrol-1-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]propyl}urea
Compound characteristics
| Compound ID: | E635-0146 |
| Compound Name: | N-(5-chloro-2-methoxyphenyl)-N'-{1-[6-methyl-2-(1H-pyrrol-1-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]propyl}urea |
| Molecular Weight: | 459.01 |
| Molecular Formula: | C23 H27 Cl N4 O2 S |
| Smiles: | CCC(c1c2CCN(C)Cc2sc1n1cccc1)NC(Nc1cc(ccc1OC)[Cl])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.6048 |
| logD: | 2.0451 |
| logSw: | -4.7377 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 48.812 |
| InChI Key: | BSTLHZQINILQCA-KRWDZBQOSA-N |