N-[(2H-1,3-benzodioxol-5-yl)methyl]-N-(1-benzylpiperidin-4-yl)-N'-(3,5-dimethylphenyl)urea
Chemical Structure Depiction of
N-[(2H-1,3-benzodioxol-5-yl)methyl]-N-(1-benzylpiperidin-4-yl)-N'-(3,5-dimethylphenyl)urea
N-[(2H-1,3-benzodioxol-5-yl)methyl]-N-(1-benzylpiperidin-4-yl)-N'-(3,5-dimethylphenyl)urea
Compound characteristics
| Compound ID: | E641-1275 |
| Compound Name: | N-[(2H-1,3-benzodioxol-5-yl)methyl]-N-(1-benzylpiperidin-4-yl)-N'-(3,5-dimethylphenyl)urea |
| Molecular Weight: | 471.6 |
| Molecular Formula: | C29 H33 N3 O3 |
| Smiles: | Cc1cc(C)cc(c1)NC(N(Cc1ccc2c(c1)OCO2)C1CCN(CC1)Cc1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.6354 |
| logD: | 4.7882 |
| logSw: | -5.4062 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.899 |
| InChI Key: | DRPPLNCCZCVSAJ-UHFFFAOYSA-N |