N-(1-benzylpiperidin-4-yl)-N'-(2-methoxy-5-methylphenyl)-N-[(5-methylfuran-2-yl)methyl]urea
Chemical Structure Depiction of
N-(1-benzylpiperidin-4-yl)-N'-(2-methoxy-5-methylphenyl)-N-[(5-methylfuran-2-yl)methyl]urea
N-(1-benzylpiperidin-4-yl)-N'-(2-methoxy-5-methylphenyl)-N-[(5-methylfuran-2-yl)methyl]urea
Compound characteristics
| Compound ID: | E641-2344 |
| Compound Name: | N-(1-benzylpiperidin-4-yl)-N'-(2-methoxy-5-methylphenyl)-N-[(5-methylfuran-2-yl)methyl]urea |
| Molecular Weight: | 447.58 |
| Molecular Formula: | C27 H33 N3 O3 |
| Smiles: | Cc1ccc(c(c1)NC(N(Cc1ccc(C)o1)C1CCN(CC1)Cc1ccccc1)=O)OC |
| Stereo: | ACHIRAL |
| logP: | 5.2247 |
| logD: | 4.3775 |
| logSw: | -5.0022 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.979 |
| InChI Key: | LFRHPFLTEIJMIZ-UHFFFAOYSA-N |