N-[(2-methoxyphenyl)methyl]-4-(5-oxopyrido[2,3-b][1,5]benzoxazepin-6(5H)-yl)butanamide
Chemical Structure Depiction of
N-[(2-methoxyphenyl)methyl]-4-(5-oxopyrido[2,3-b][1,5]benzoxazepin-6(5H)-yl)butanamide
N-[(2-methoxyphenyl)methyl]-4-(5-oxopyrido[2,3-b][1,5]benzoxazepin-6(5H)-yl)butanamide
Compound characteristics
| Compound ID: | E645-1939 |
| Compound Name: | N-[(2-methoxyphenyl)methyl]-4-(5-oxopyrido[2,3-b][1,5]benzoxazepin-6(5H)-yl)butanamide |
| Molecular Weight: | 417.46 |
| Molecular Formula: | C24 H23 N3 O4 |
| Smiles: | COc1ccccc1CNC(CCCN1C(c2cccnc2Oc2ccccc12)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9225 |
| logD: | 2.9225 |
| logSw: | -3.564 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 64.612 |
| InChI Key: | RLCIJQWYQFDHPI-UHFFFAOYSA-N |