N-benzyl-1-(3-chloro-2-methylphenyl)-4-(methanesulfonyl)-2-methyl-6-oxopiperazine-2-carboxamide
Chemical Structure Depiction of
N-benzyl-1-(3-chloro-2-methylphenyl)-4-(methanesulfonyl)-2-methyl-6-oxopiperazine-2-carboxamide
N-benzyl-1-(3-chloro-2-methylphenyl)-4-(methanesulfonyl)-2-methyl-6-oxopiperazine-2-carboxamide
Compound characteristics
| Compound ID: | E646-3117 |
| Compound Name: | N-benzyl-1-(3-chloro-2-methylphenyl)-4-(methanesulfonyl)-2-methyl-6-oxopiperazine-2-carboxamide |
| Molecular Weight: | 449.96 |
| Molecular Formula: | C21 H24 Cl N3 O4 S |
| Smiles: | Cc1c(cccc1[Cl])N1C(CN(CC1(C)C(NCc1ccccc1)=O)S(C)(=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.5878 |
| logD: | 2.5878 |
| logSw: | -3.2659 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 71.133 |
| InChI Key: | KORODKBSNSEZEN-NRFANRHFSA-N |