4-(benzenesulfonyl)-1-(4-fluorophenyl)-2-methyl-N-[(4-methylphenyl)methyl]-6-oxopiperazine-2-carboxamide
Chemical Structure Depiction of
4-(benzenesulfonyl)-1-(4-fluorophenyl)-2-methyl-N-[(4-methylphenyl)methyl]-6-oxopiperazine-2-carboxamide
4-(benzenesulfonyl)-1-(4-fluorophenyl)-2-methyl-N-[(4-methylphenyl)methyl]-6-oxopiperazine-2-carboxamide
Compound characteristics
| Compound ID: | E646-4057 |
| Compound Name: | 4-(benzenesulfonyl)-1-(4-fluorophenyl)-2-methyl-N-[(4-methylphenyl)methyl]-6-oxopiperazine-2-carboxamide |
| Molecular Weight: | 495.57 |
| Molecular Formula: | C26 H26 F N3 O4 S |
| Smiles: | Cc1ccc(CNC(C2(C)CN(CC(N2c2ccc(cc2)F)=O)S(c2ccccc2)(=O)=O)=O)cc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.4135 |
| logD: | 3.4134 |
| logSw: | -3.8161 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 71.67 |
| InChI Key: | AHAPGURZCFVBOZ-SANMLTNESA-N |