1-cyclopropyl-4-(4-methoxybenzene-1-sulfonyl)-2-methyl-N-[(4-methylphenyl)methyl]-6-oxopiperazine-2-carboxamide
Chemical Structure Depiction of
1-cyclopropyl-4-(4-methoxybenzene-1-sulfonyl)-2-methyl-N-[(4-methylphenyl)methyl]-6-oxopiperazine-2-carboxamide
1-cyclopropyl-4-(4-methoxybenzene-1-sulfonyl)-2-methyl-N-[(4-methylphenyl)methyl]-6-oxopiperazine-2-carboxamide
Compound characteristics
| Compound ID: | E646-4099 |
| Compound Name: | 1-cyclopropyl-4-(4-methoxybenzene-1-sulfonyl)-2-methyl-N-[(4-methylphenyl)methyl]-6-oxopiperazine-2-carboxamide |
| Molecular Weight: | 471.57 |
| Molecular Formula: | C24 H29 N3 O5 S |
| Smiles: | Cc1ccc(CNC(C2(C)CN(CC(N2C2CC2)=O)S(c2ccc(cc2)OC)(=O)=O)=O)cc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.869 |
| logD: | 2.8688 |
| logSw: | -3.5332 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 79.378 |
| InChI Key: | ANOWIKKLBIHWFM-DEOSSOPVSA-N |