ethyl 4-acetamido-6-[2-(2-methoxyanilino)-2-oxoethyl]-2,3-dimethyl-6H-thieno[2,3-b]pyrrole-5-carboxylate
Chemical Structure Depiction of
ethyl 4-acetamido-6-[2-(2-methoxyanilino)-2-oxoethyl]-2,3-dimethyl-6H-thieno[2,3-b]pyrrole-5-carboxylate
ethyl 4-acetamido-6-[2-(2-methoxyanilino)-2-oxoethyl]-2,3-dimethyl-6H-thieno[2,3-b]pyrrole-5-carboxylate
Compound characteristics
| Compound ID: | E649-1586 |
| Compound Name: | ethyl 4-acetamido-6-[2-(2-methoxyanilino)-2-oxoethyl]-2,3-dimethyl-6H-thieno[2,3-b]pyrrole-5-carboxylate |
| Molecular Weight: | 443.52 |
| Molecular Formula: | C22 H25 N3 O5 S |
| Smiles: | CCOC(c1c(c2c(C)c(C)sc2n1CC(Nc1ccccc1OC)=O)NC(C)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.7086 |
| logD: | 2.0096 |
| logSw: | -3.0036 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 74.024 |
| InChI Key: | NDASSWCQULAMSR-UHFFFAOYSA-N |