N-[3-(dimethylamino)propyl]-4-fluoro-N-(4-methyl-1,3-benzothiazol-2-yl)benzamide--hydrogen chloride (1/1)
Chemical Structure Depiction of
N-[3-(dimethylamino)propyl]-4-fluoro-N-(4-methyl-1,3-benzothiazol-2-yl)benzamide--hydrogen chloride (1/1)
N-[3-(dimethylamino)propyl]-4-fluoro-N-(4-methyl-1,3-benzothiazol-2-yl)benzamide--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | E677-0901 |
| Compound Name: | N-[3-(dimethylamino)propyl]-4-fluoro-N-(4-methyl-1,3-benzothiazol-2-yl)benzamide--hydrogen chloride (1/1) |
| Molecular Weight: | 407.94 |
| Molecular Formula: | C20 H22 F N3 O S |
| Salt: | HCl |
| Smiles: | Cc1cccc2c1nc(N(CCCN(C)C)C(c1ccc(cc1)F)=O)s2 |
| Stereo: | ACHIRAL |
| logP: | 4.2585 |
| logD: | 2.1107 |
| logSw: | -4.2256 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 30.011 |
| InChI Key: | FEBDROGNLVWHLZ-UHFFFAOYSA-N |