4-benzyl-N-[3-(dimethylamino)propyl]-N-(4-fluoro-1,3-benzothiazol-2-yl)benzamide--hydrogen chloride (1/1)
Chemical Structure Depiction of
4-benzyl-N-[3-(dimethylamino)propyl]-N-(4-fluoro-1,3-benzothiazol-2-yl)benzamide--hydrogen chloride (1/1)
4-benzyl-N-[3-(dimethylamino)propyl]-N-(4-fluoro-1,3-benzothiazol-2-yl)benzamide--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | E677-1352 |
| Compound Name: | 4-benzyl-N-[3-(dimethylamino)propyl]-N-(4-fluoro-1,3-benzothiazol-2-yl)benzamide--hydrogen chloride (1/1) |
| Molecular Weight: | 484.04 |
| Molecular Formula: | C26 H26 F N3 O S |
| Salt: | HCl |
| Smiles: | CN(C)CCCN(C(c1ccc(Cc2ccccc2)cc1)=O)c1nc2c(cccc2s1)F |
| Stereo: | ACHIRAL |
| logP: | 5.5637 |
| logD: | 3.4159 |
| logSw: | -5.3744 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 29.7394 |
| InChI Key: | ZHHPUHCPUUHGSG-UHFFFAOYSA-N |