N-(4,6-difluoro-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]thiophene-2-carboxamide--hydrogen chloride (1/1)
Chemical Structure Depiction of
N-(4,6-difluoro-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]thiophene-2-carboxamide--hydrogen chloride (1/1)
N-(4,6-difluoro-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]thiophene-2-carboxamide--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | E677-2689 |
| Compound Name: | N-(4,6-difluoro-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]thiophene-2-carboxamide--hydrogen chloride (1/1) |
| Molecular Weight: | 417.93 |
| Molecular Formula: | C17 H17 F2 N3 O S2 |
| Salt: | HCl |
| Smiles: | CN(C)CCCN(C(c1cccs1)=O)c1nc2c(cc(cc2s1)F)F |
| Stereo: | ACHIRAL |
| logP: | 4.0328 |
| logD: | 1.885 |
| logSw: | -4.0545 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 31.0293 |
| InChI Key: | QHHZQQCLMJTJEK-UHFFFAOYSA-N |