N-[4-(propan-2-yl)phenyl]-7,8,9,10-tetrahydro-6H-azepino[1,2-e]purin-4-amine
Chemical Structure Depiction of
N-[4-(propan-2-yl)phenyl]-7,8,9,10-tetrahydro-6H-azepino[1,2-e]purin-4-amine
N-[4-(propan-2-yl)phenyl]-7,8,9,10-tetrahydro-6H-azepino[1,2-e]purin-4-amine
Compound characteristics
| Compound ID: | E679-0685 |
| Compound Name: | N-[4-(propan-2-yl)phenyl]-7,8,9,10-tetrahydro-6H-azepino[1,2-e]purin-4-amine |
| Molecular Weight: | 321.42 |
| Molecular Formula: | C19 H23 N5 |
| Smiles: | CC(C)c1ccc(cc1)Nc1c2c(ncn1)n1CCCCCc1n2 |
| Stereo: | ACHIRAL |
| logP: | 4.4736 |
| logD: | 4.4733 |
| logSw: | -4.1983 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.762 |
| InChI Key: | ZOXQWOYNWJTRIY-UHFFFAOYSA-N |