6-(4-methoxyphenyl)-7-[2-(trifluoromethyl)anilino]-6,7-dihydro-5H-pyrrolo[3,4-b]pyridin-5-one
Chemical Structure Depiction of
6-(4-methoxyphenyl)-7-[2-(trifluoromethyl)anilino]-6,7-dihydro-5H-pyrrolo[3,4-b]pyridin-5-one
6-(4-methoxyphenyl)-7-[2-(trifluoromethyl)anilino]-6,7-dihydro-5H-pyrrolo[3,4-b]pyridin-5-one
Compound characteristics
| Compound ID: | E680-0005 |
| Compound Name: | 6-(4-methoxyphenyl)-7-[2-(trifluoromethyl)anilino]-6,7-dihydro-5H-pyrrolo[3,4-b]pyridin-5-one |
| Molecular Weight: | 399.37 |
| Molecular Formula: | C21 H16 F3 N3 O2 |
| Smiles: | COc1ccc(cc1)N1C(c2c(cccn2)C1=O)Nc1ccccc1C(F)(F)F |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.1851 |
| logD: | 4.1851 |
| logSw: | -4.3863 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.145 |
| InChI Key: | LNDWKGSTRUVPGK-IBGZPJMESA-N |