ethyl 4-(2-{3-[(2-fluorophenyl)methanesulfonyl]-1H-indol-1-yl}acetamido)benzoate
Chemical Structure Depiction of
ethyl 4-(2-{3-[(2-fluorophenyl)methanesulfonyl]-1H-indol-1-yl}acetamido)benzoate
ethyl 4-(2-{3-[(2-fluorophenyl)methanesulfonyl]-1H-indol-1-yl}acetamido)benzoate
Compound characteristics
| Compound ID: | E690-0236 |
| Compound Name: | ethyl 4-(2-{3-[(2-fluorophenyl)methanesulfonyl]-1H-indol-1-yl}acetamido)benzoate |
| Molecular Weight: | 494.54 |
| Molecular Formula: | C26 H23 F N2 O5 S |
| Smiles: | CCOC(c1ccc(cc1)NC(Cn1cc(c2ccccc12)S(Cc1ccccc1F)(=O)=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.0413 |
| logD: | 5.041 |
| logSw: | -4.6545 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 74.638 |
| InChI Key: | CCUZRFCFDQRJLT-UHFFFAOYSA-N |