2-{3-[(3-chlorophenyl)methanesulfonyl]-1H-indol-1-yl}-N-(3-methoxyphenyl)acetamide
Chemical Structure Depiction of
2-{3-[(3-chlorophenyl)methanesulfonyl]-1H-indol-1-yl}-N-(3-methoxyphenyl)acetamide
2-{3-[(3-chlorophenyl)methanesulfonyl]-1H-indol-1-yl}-N-(3-methoxyphenyl)acetamide
Compound characteristics
| Compound ID: | E690-0335 |
| Compound Name: | 2-{3-[(3-chlorophenyl)methanesulfonyl]-1H-indol-1-yl}-N-(3-methoxyphenyl)acetamide |
| Molecular Weight: | 468.96 |
| Molecular Formula: | C24 H21 Cl N2 O4 S |
| Smiles: | COc1cccc(c1)NC(Cn1cc(c2ccccc12)S(Cc1cccc(c1)[Cl])(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.8973 |
| logD: | 4.8972 |
| logSw: | -4.8832 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.428 |
| InChI Key: | MPWVGCBTGIJOOQ-UHFFFAOYSA-N |