2-{3-[(2-chlorophenyl)methanesulfonyl]-1H-indol-1-yl}-N-(2,4-difluorophenyl)acetamide
Chemical Structure Depiction of
2-{3-[(2-chlorophenyl)methanesulfonyl]-1H-indol-1-yl}-N-(2,4-difluorophenyl)acetamide
2-{3-[(2-chlorophenyl)methanesulfonyl]-1H-indol-1-yl}-N-(2,4-difluorophenyl)acetamide
Compound characteristics
| Compound ID: | E690-0530 |
| Compound Name: | 2-{3-[(2-chlorophenyl)methanesulfonyl]-1H-indol-1-yl}-N-(2,4-difluorophenyl)acetamide |
| Molecular Weight: | 474.91 |
| Molecular Formula: | C23 H17 Cl F2 N2 O3 S |
| Smiles: | C(C(Nc1ccc(cc1F)F)=O)n1cc(c2ccccc12)S(Cc1ccccc1[Cl])(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7279 |
| logD: | 4.7013 |
| logSw: | -4.9776 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.187 |
| InChI Key: | RJTQVNPXBWOGSM-UHFFFAOYSA-N |