N-[(2-bromophenyl)methyl]-1-[ethyl(4-methoxyphenyl)sulfamoyl]piperidine-3-carboxamide
Chemical Structure Depiction of
N-[(2-bromophenyl)methyl]-1-[ethyl(4-methoxyphenyl)sulfamoyl]piperidine-3-carboxamide
N-[(2-bromophenyl)methyl]-1-[ethyl(4-methoxyphenyl)sulfamoyl]piperidine-3-carboxamide
Compound characteristics
| Compound ID: | E692-2107 |
| Compound Name: | N-[(2-bromophenyl)methyl]-1-[ethyl(4-methoxyphenyl)sulfamoyl]piperidine-3-carboxamide |
| Molecular Weight: | 510.45 |
| Molecular Formula: | C22 H28 Br N3 O4 S |
| Smiles: | CCN(c1ccc(cc1)OC)S(N1CCCC(C1)C(NCc1ccccc1[Br])=O)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.2677 |
| logD: | 3.2677 |
| logSw: | -3.406 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.085 |
| InChI Key: | GBGGHUKDOVTPEX-SFHVURJKSA-N |