N-(4-chloro-2-methylphenyl)-6,7,8,9-tetrahydropyrido[1,2-e]purin-4-amine
Chemical Structure Depiction of
N-(4-chloro-2-methylphenyl)-6,7,8,9-tetrahydropyrido[1,2-e]purin-4-amine
N-(4-chloro-2-methylphenyl)-6,7,8,9-tetrahydropyrido[1,2-e]purin-4-amine
Compound characteristics
| Compound ID: | E715-0971 |
| Compound Name: | N-(4-chloro-2-methylphenyl)-6,7,8,9-tetrahydropyrido[1,2-e]purin-4-amine |
| Molecular Weight: | 313.79 |
| Molecular Formula: | C16 H16 Cl N5 |
| Smiles: | Cc1cc(ccc1Nc1c2c(ncn1)n1CCCCc1n2)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 3.8171 |
| logD: | 3.8168 |
| logSw: | -4.1225 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.733 |
| InChI Key: | QVPBTSOYOZRLAK-UHFFFAOYSA-N |