N-(3-chloro-4-methoxyphenyl)-2-({[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl}sulfanyl)acetamide
Chemical Structure Depiction of
N-(3-chloro-4-methoxyphenyl)-2-({[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl}sulfanyl)acetamide
N-(3-chloro-4-methoxyphenyl)-2-({[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl}sulfanyl)acetamide
Compound characteristics
| Compound ID: | E716-0014 |
| Compound Name: | N-(3-chloro-4-methoxyphenyl)-2-({[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl}sulfanyl)acetamide |
| Molecular Weight: | 419.89 |
| Molecular Formula: | C19 H18 Cl N3 O4 S |
| Smiles: | COc1ccc(cc1)c1nc(CSCC(Nc2ccc(c(c2)[Cl])OC)=O)on1 |
| Stereo: | ACHIRAL |
| logP: | 4.8037 |
| logD: | 4.8034 |
| logSw: | -4.9947 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 69.633 |
| InChI Key: | DMYDXLHXNGLUSW-UHFFFAOYSA-N |