N-(3,5-dimethoxyphenyl)-2,3-dimethyl-4H-thieno[3,2-c]thiopyran-6-carboxamide
Chemical Structure Depiction of
N-(3,5-dimethoxyphenyl)-2,3-dimethyl-4H-thieno[3,2-c]thiopyran-6-carboxamide
N-(3,5-dimethoxyphenyl)-2,3-dimethyl-4H-thieno[3,2-c]thiopyran-6-carboxamide
Compound characteristics
| Compound ID: | E722-1298 |
| Compound Name: | N-(3,5-dimethoxyphenyl)-2,3-dimethyl-4H-thieno[3,2-c]thiopyran-6-carboxamide |
| Molecular Weight: | 361.48 |
| Molecular Formula: | C18 H19 N O3 S2 |
| Smiles: | Cc1c2CSC(=Cc2sc1C)C(Nc1cc(cc(c1)OC)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7792 |
| logD: | 4.7791 |
| logSw: | -4.495 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.356 |
| InChI Key: | FVYQCQWCRDQAQS-UHFFFAOYSA-N |