N-(3-fluorophenyl)-4-methyl-2-(methylsulfanyl)pyrimidine-5-carboxamide
Chemical Structure Depiction of
N-(3-fluorophenyl)-4-methyl-2-(methylsulfanyl)pyrimidine-5-carboxamide
N-(3-fluorophenyl)-4-methyl-2-(methylsulfanyl)pyrimidine-5-carboxamide
Compound characteristics
| Compound ID: | E727-0059 |
| Compound Name: | N-(3-fluorophenyl)-4-methyl-2-(methylsulfanyl)pyrimidine-5-carboxamide |
| Molecular Weight: | 277.32 |
| Molecular Formula: | C13 H12 F N3 O S |
| Smiles: | Cc1c(cnc(n1)SC)C(Nc1cccc(c1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 2.7786 |
| logD: | 2.7186 |
| logSw: | -3.419 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.721 |
| InChI Key: | XWBWYQNEUPPRTO-UHFFFAOYSA-N |