N-(3-chloro-4-fluorophenyl)-7-methyl-2,3-dioxo-1,2,3,4-tetrahydroquinoxaline-6-sulfonamide
Chemical Structure Depiction of
N-(3-chloro-4-fluorophenyl)-7-methyl-2,3-dioxo-1,2,3,4-tetrahydroquinoxaline-6-sulfonamide
N-(3-chloro-4-fluorophenyl)-7-methyl-2,3-dioxo-1,2,3,4-tetrahydroquinoxaline-6-sulfonamide
Compound characteristics
| Compound ID: | E734-0140 |
| Compound Name: | N-(3-chloro-4-fluorophenyl)-7-methyl-2,3-dioxo-1,2,3,4-tetrahydroquinoxaline-6-sulfonamide |
| Molecular Weight: | 383.78 |
| Molecular Formula: | C15 H11 Cl F N3 O4 S |
| Smiles: | Cc1cc2c(cc1S(Nc1ccc(c(c1)[Cl])F)(=O)=O)NC(C(N2)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.2426 |
| logD: | -0.032 |
| logSw: | -3.167 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 90.723 |
| InChI Key: | QKELSWYPUOIQQN-UHFFFAOYSA-N |