methyl {3-[(3-methoxyphenyl)sulfamoyl]-5-nitro-1H-indol-1-yl}acetate
Chemical Structure Depiction of
methyl {3-[(3-methoxyphenyl)sulfamoyl]-5-nitro-1H-indol-1-yl}acetate
methyl {3-[(3-methoxyphenyl)sulfamoyl]-5-nitro-1H-indol-1-yl}acetate
Compound characteristics
| Compound ID: | E734-2012 |
| Compound Name: | methyl {3-[(3-methoxyphenyl)sulfamoyl]-5-nitro-1H-indol-1-yl}acetate |
| Molecular Weight: | 419.41 |
| Molecular Formula: | C18 H17 N3 O7 S |
| Smiles: | COC(Cn1cc(c2cc(ccc12)[N+]([O-])=O)S(Nc1cccc(c1)OC)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5263 |
| logD: | 1.3296 |
| logSw: | -2.9566 |
| Hydrogen bond acceptors count: | 12 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 104.396 |
| InChI Key: | MIAPSJWWICCGIS-UHFFFAOYSA-N |