2-[8-methoxy-3-(4-methoxyphenyl)-5-methyl-2,4-dioxo-2,3,4,5-tetrahydro-1H-pyrimido[5,4-b]indol-1-yl]-N-(3-methoxypropyl)acetamide
Chemical Structure Depiction of
2-[8-methoxy-3-(4-methoxyphenyl)-5-methyl-2,4-dioxo-2,3,4,5-tetrahydro-1H-pyrimido[5,4-b]indol-1-yl]-N-(3-methoxypropyl)acetamide
2-[8-methoxy-3-(4-methoxyphenyl)-5-methyl-2,4-dioxo-2,3,4,5-tetrahydro-1H-pyrimido[5,4-b]indol-1-yl]-N-(3-methoxypropyl)acetamide
Compound characteristics
| Compound ID: | E737-1042 |
| Compound Name: | 2-[8-methoxy-3-(4-methoxyphenyl)-5-methyl-2,4-dioxo-2,3,4,5-tetrahydro-1H-pyrimido[5,4-b]indol-1-yl]-N-(3-methoxypropyl)acetamide |
| Molecular Weight: | 480.52 |
| Molecular Formula: | C25 H28 N4 O6 |
| Smiles: | Cn1c2C(N(C(N(CC(NCCCOC)=O)c2c2cc(ccc12)OC)=O)c1ccc(cc1)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 1.8622 |
| logD: | 1.8622 |
| logSw: | -2.7002 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 81.75 |
| InChI Key: | KDLXLQLEHSYLEY-UHFFFAOYSA-N |