ethyl 3-(2-{1-(4-chlorophenyl)-3-[(4-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl}acetamido)benzoate
Chemical Structure Depiction of
ethyl 3-(2-{1-(4-chlorophenyl)-3-[(4-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl}acetamido)benzoate
ethyl 3-(2-{1-(4-chlorophenyl)-3-[(4-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl}acetamido)benzoate
Compound characteristics
| Compound ID: | E750-0546 |
| Compound Name: | ethyl 3-(2-{1-(4-chlorophenyl)-3-[(4-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl}acetamido)benzoate |
| Molecular Weight: | 523.95 |
| Molecular Formula: | C27 H23 Cl F N3 O5 |
| Smiles: | CCOC(c1cccc(c1)NC(CC1C(N(C(N1Cc1ccc(cc1)F)=O)c1ccc(cc1)[Cl])=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.7245 |
| logD: | 4.7245 |
| logSw: | -4.8813 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 75.458 |
| InChI Key: | HLQUUTRURUZBHZ-HSZRJFAPSA-N |