N-(2,6-dimethylphenyl)-3-methyl-1-(4-methylphenyl)-5-(1H-pyrrol-1-yl)-1H-pyrazole-4-carboxamide
Chemical Structure Depiction of
N-(2,6-dimethylphenyl)-3-methyl-1-(4-methylphenyl)-5-(1H-pyrrol-1-yl)-1H-pyrazole-4-carboxamide
N-(2,6-dimethylphenyl)-3-methyl-1-(4-methylphenyl)-5-(1H-pyrrol-1-yl)-1H-pyrazole-4-carboxamide
Compound characteristics
| Compound ID: | E751-3694 |
| Compound Name: | N-(2,6-dimethylphenyl)-3-methyl-1-(4-methylphenyl)-5-(1H-pyrrol-1-yl)-1H-pyrazole-4-carboxamide |
| Molecular Weight: | 384.48 |
| Molecular Formula: | C24 H24 N4 O |
| Smiles: | Cc1ccc(cc1)n1c(c(C(Nc2c(C)cccc2C)=O)c(C)n1)n1cccc1 |
| Stereo: | ACHIRAL |
| logP: | 4.7402 |
| logD: | 4.7402 |
| logSw: | -4.6116 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.144 |
| InChI Key: | KILBEISYQFLGTR-UHFFFAOYSA-N |